CAS 568566-63-2 appears in our catalog under these names: 2-(2-Chloro-benzylamino)-5-nitro-benzoic acid, 95%, 2-{((2-chlorophenyl)methyl)amino}-5-nitrobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(2-chlorophenyl)methylamino]-5-nitrobenzoic acid (CAS 568566-63-2) is a chemical compound with the molecular formula C14H11ClN2O4 and a molecular weight of 306.70 g/mol. IUPAC name: 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoic acid. InChIKey: DCERYSHTLDLALI-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O4 |
|---|---|
| Molecular weight | 306.70 g/mol |
| IUPAC name | 2-[(2-chlorophenyl)methylamino]-5-nitrobenzoic acid |
| InChIKey | DCERYSHTLDLALI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=C(C=C(C=C2)[N+](=O)[O-])C(=O)O)Cl |
Computed by PubChem (NCBI)