CAS 1000025-07-9 appears in our catalog under these names: Vadadustat, 97%, Vadadustat (AKB-6548), Vadadustat, >95% (HPLC), Vadadustat/ 99.4% (existing batch purity), Vadadustat. Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 100mg, 1g, 250mg, on request, 25mg, 50mg, 5mg, 1mg.
2-[[5-(3-chlorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetic acid (CAS 1000025-07-9) is a chemical compound with the molecular formula C14H11ClN2O4 and a molecular weight of 306.70 g/mol. IUPAC name: 2-[[5-(3-chlorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetic acid. InChIKey: JGRXMPYUTJLTKT-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O4 |
|---|---|
| Molecular weight | 306.70 g/mol |
| IUPAC name | 2-[[5-(3-chlorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetic acid |
| InChIKey | JGRXMPYUTJLTKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC(=C(N=C2)C(=O)NCC(=O)O)O |
Computed by PubChem (NCBI)