Products 1881293-60-2
CAS 1881293-60-2 is the registry number for 1,5-dichloro-3-ethoxy-2-methoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,5-dichloro-3-ethoxy-2-methoxybenzene (CAS 1881293-60-2) is a chemical compound with the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. IUPAC name: 1,5-dichloro-3-ethoxy-2-methoxybenzene. InChIKey: MYJVWISEQDHRPF-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O2 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 1,5-dichloro-3-ethoxy-2-methoxybenzene |
| InChIKey | MYJVWISEQDHRPF-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)Cl)Cl)OC |
Computed by PubChem (NCBI)