Products 1881321-09-0
CAS 1881321-09-0 is the registry number for 2,3-dichloro-4-(propan-2-yloxy)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,3-dichloro-4-propan-2-yloxyphenol (CAS 1881321-09-0) is a chemical compound with the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. IUPAC name: 2,3-dichloro-4-propan-2-yloxyphenol. InChIKey: GVDDLKCXQMFYJV-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O2 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 2,3-dichloro-4-propan-2-yloxyphenol |
| InChIKey | GVDDLKCXQMFYJV-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=C(C=C1)O)Cl)Cl |
Computed by PubChem (NCBI)