CAS 93983-14-3 appears in our catalog under these names: 2-Chloro-1-(chloromethyl)-3,4-dimethoxybenzene, 95%, 2–chloro–1–(chloromethyl)–3,4–dimethoxybenzene. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-1-(chloromethyl)-3,4-dimethoxybenzene (CAS 93983-14-3) is a chemical compound with the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. IUPAC name: 2-chloro-1-(chloromethyl)-3,4-dimethoxybenzene. InChIKey: ZRCXRIHUKHLNFX-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O2 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 2-chloro-1-(chloromethyl)-3,4-dimethoxybenzene |
| InChIKey | ZRCXRIHUKHLNFX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CCl)Cl)OC |
Computed by PubChem (NCBI)