CAS 1881295-47-1 is the registry number for 1,5-dichloro-2,3-bis(propan-2-yloxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,5-dichloro-2,3-di(propan-2-yloxy)benzene (CAS 1881295-47-1) is a chemical compound with the molecular formula C12H16Cl2O2 and a molecular weight of 263.16 g/mol. IUPAC name: 1,5-dichloro-2,3-di(propan-2-yloxy)benzene. InChIKey: UQIGJCJYUMJLLP-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2O2 |
|---|---|
| Molecular weight | 263.16 g/mol |
| IUPAC name | 1,5-dichloro-2,3-di(propan-2-yloxy)benzene |
| InChIKey | UQIGJCJYUMJLLP-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=CC(=C1)Cl)Cl)OC(C)C |
Computed by PubChem (NCBI)