Products 2734777-79-6
CAS 2734777-79-6 is the registry number for 2,2-Dichloro-1-(5-isopropoxy-2-methylphenyl)ethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2-dichloro-1-(2-methyl-5-propan-2-yloxyphenyl)ethanol (CAS 2734777-79-6) is a chemical compound with the molecular formula C12H16Cl2O2 and a molecular weight of 263.16 g/mol. IUPAC name: 2,2-dichloro-1-(2-methyl-5-propan-2-yloxyphenyl)ethanol. InChIKey: FRJSXXDRWVUTAQ-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2O2 |
|---|---|
| Molecular weight | 263.16 g/mol |
| IUPAC name | 2,2-dichloro-1-(2-methyl-5-propan-2-yloxyphenyl)ethanol |
| InChIKey | FRJSXXDRWVUTAQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC(C)C)C(C(Cl)Cl)O |
Computed by PubChem (NCBI)