CAS 1881296-08-7 is the registry number for 3-fluoro-4-nitropyridine hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-fluoro-4-nitropyridine;hydrate (CAS 1881296-08-7) is a chemical compound with the molecular formula C5H5FN2O3 and a molecular weight of 160.10 g/mol. IUPAC name: 3-fluoro-4-nitropyridine;hydrate. InChIKey: WIPKKKWBDFKUQN-UHFFFAOYSA-N.
| Molecular formula | C5H5FN2O3 |
|---|---|
| Molecular weight | 160.10 g/mol |
| IUPAC name | 3-fluoro-4-nitropyridine;hydrate |
| InChIKey | WIPKKKWBDFKUQN-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1[N+](=O)[O-])F.O |
Computed by PubChem (NCBI)