CAS 1881328-77-3 is the registry number for 2-fluoro-3-nitropyridine hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-fluoro-3-nitropyridine;hydrate (CAS 1881328-77-3) is a chemical compound with the molecular formula C5H5FN2O3 and a molecular weight of 160.10 g/mol. IUPAC name: 2-fluoro-3-nitropyridine;hydrate. InChIKey: CILGENJNBXXOJB-UHFFFAOYSA-N.
| Molecular formula | C5H5FN2O3 |
|---|---|
| Molecular weight | 160.10 g/mol |
| IUPAC name | 2-fluoro-3-nitropyridine;hydrate |
| InChIKey | CILGENJNBXXOJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)F)[N+](=O)[O-].O |
Computed by PubChem (NCBI)