Products 1881296-38-3
CAS 1881296-38-3 is the registry number for benzyl N-(4-chlorophenyl)-N-methylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Benzyl N-(4-chlorophenyl)-N-methylcarbamate (CAS 1881296-38-3) is a chemical compound with the molecular formula C15H14ClNO2 and a molecular weight of 275.73 g/mol. IUPAC name: benzyl N-(4-chlorophenyl)-N-methylcarbamate. InChIKey: CYOMZLAURWRZLE-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO2 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | benzyl N-(4-chlorophenyl)-N-methylcarbamate |
| InChIKey | CYOMZLAURWRZLE-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)Cl)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)