Products 881823-93-4
CAS 881823-93-4 appears in our catalog under these names: 2-{(2-(4-Chlorophenyl)ethyl)amino}benzoic acid, 2-([2-(4-Chlorophenyl)ethyl]amino)benzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 10g, 250mg, 100mg, 1g.
2-[2-(4-chlorophenyl)ethylamino]benzoic acid (CAS 881823-93-4) is a chemical compound with the molecular formula C15H14ClNO2 and a molecular weight of 275.73 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)ethylamino]benzoic acid. InChIKey: KNCYBGUGQJEWTB-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO2 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)ethylamino]benzoic acid |
| InChIKey | KNCYBGUGQJEWTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NCCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)