Products 1206969-44-9
CAS 1206969-44-9 is the registry number for 5-(4-(1,3-Dioxan-2-yl)phenyl)-2-chloropyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-chloro-5-[4-(1,3-dioxan-2-yl)phenyl]pyridine (CAS 1206969-44-9) is a chemical compound with the molecular formula C15H14ClNO2 and a molecular weight of 275.73 g/mol. IUPAC name: 2-chloro-5-[4-(1,3-dioxan-2-yl)phenyl]pyridine. InChIKey: NZFXAAKPSHLLQD-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO2 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | 2-chloro-5-[4-(1,3-dioxan-2-yl)phenyl]pyridine |
| InChIKey | NZFXAAKPSHLLQD-UHFFFAOYSA-N |
| SMILES | C1COC(OC1)C2=CC=C(C=C2)C3=CN=C(C=C3)Cl |
Computed by PubChem (NCBI)