CAS 1881296-54-3 is the registry number for 2-methyl-5-nitropyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-methyl-5-nitropyridine;hydrochloride (CAS 1881296-54-3) is a chemical compound with the molecular formula C6H7ClN2O2 and a molecular weight of 174.58 g/mol. IUPAC name: 2-methyl-5-nitropyridine;hydrochloride. InChIKey: FEWWUTVIUODFGH-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2 |
|---|---|
| Molecular weight | 174.58 g/mol |
| IUPAC name | 2-methyl-5-nitropyridine;hydrochloride |
| InChIKey | FEWWUTVIUODFGH-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)