Products 3057-91-8
CAS 3057-91-8 appears in our catalog under these names: Spiro[3.3]heptane-2,6-dicarboxylic acid, 97%, Spiro(3.3)heptane-2,6-dicarboxylic acid, Spiro[3.3]heptane-2,6-dicarboxylic acid 97%, spiro[3.3]heptane-2,6-dicarboxylic acid, 96%, 96%, Spiro[3.3]heptane-2,6-dicarboxylic acid, 96%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 0,5g, 10g, 100mg.
Spiro[3.3]heptane-2,6-dicarboxylic acid (CAS 3057-91-8) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: spiro[3.3]heptane-2,6-dicarboxylic acid. InChIKey: JQZAKMJZYGPUFD-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | spiro[3.3]heptane-2,6-dicarboxylic acid |
| InChIKey | JQZAKMJZYGPUFD-UHFFFAOYSA-N |
| SMILES | C1C(CC12CC(C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)