CAS 1881321-91-0 appears in our catalog under these names: 1-chloro-3-fluoro-4-methoxy-2-nitrobenzene, 95%, 1-Chloro-3-fluoro-4-methoxy-2-nitrobenzene 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-chloro-3-fluoro-4-methoxy-2-nitrobenzene (CAS 1881321-91-0) is a chemical compound with the molecular formula C7H5ClFNO3 and a molecular weight of 205.57 g/mol. IUPAC name: 1-chloro-3-fluoro-4-methoxy-2-nitrobenzene. InChIKey: IYJQIXWTMWDXKW-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO3 |
|---|---|
| Molecular weight | 205.57 g/mol |
| IUPAC name | 1-chloro-3-fluoro-4-methoxy-2-nitrobenzene |
| InChIKey | IYJQIXWTMWDXKW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Cl)[N+](=O)[O-])F |
Computed by PubChem (NCBI)