CAS 2639626-58-5 is the registry number for 1-Chloro-2-fluoro-3-(methoxy-d3)-5-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-chloro-2-fluoro-5-nitro-3-(trideuteriomethoxy)benzene (CAS 2639626-58-5) is a chemical compound with the molecular formula C7H5ClFNO3 and a molecular weight of 208.59 g/mol. IUPAC name: 1-chloro-2-fluoro-5-nitro-3-(trideuteriomethoxy)benzene. InChIKey: WQSMAOWDIZHSBT-FIBGUPNXSA-N.
| Molecular formula | C7H5ClFNO3 |
|---|---|
| Molecular weight | 208.59 g/mol |
| IUPAC name | 1-chloro-2-fluoro-5-nitro-3-(trideuteriomethoxy)benzene |
| InChIKey | WQSMAOWDIZHSBT-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C(=CC(=C1)[N+](=O)[O-])Cl)F |
Computed by PubChem (NCBI)