CAS 1881322-21-9 is the registry number for 2-ethoxy-1,3-difluoro-4-methyl-5-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-ethoxy-1,3-difluoro-4-methyl-5-nitrobenzene (CAS 1881322-21-9) is a chemical compound with the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. IUPAC name: 2-ethoxy-1,3-difluoro-4-methyl-5-nitrobenzene. InChIKey: HMLAPXMLHVYSLT-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO3 |
|---|---|
| Molecular weight | 217.17 g/mol |
| IUPAC name | 2-ethoxy-1,3-difluoro-4-methyl-5-nitrobenzene |
| InChIKey | HMLAPXMLHVYSLT-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1F)C)[N+](=O)[O-])F |
Computed by PubChem (NCBI)