Products 1860876-20-5

CAS 1860876-20-5 is the registry number for 2-(3-Ethoxypyridin-2-yl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(3-ethoxy-2-pyridinyl)-2,2-difluoroacetic acid (CAS 1860876-20-5) is a chemical compound with the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. IUPAC name: 2-(3-ethoxy-2-pyridinyl)-2,2-difluoroacetic acid. InChIKey: WNORXAUSFMBNNE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9F2NO3
Molecular weight217.17 g/mol
IUPAC name2-(3-ethoxy-2-pyridinyl)-2,2-difluoroacetic acid
InChIKeyWNORXAUSFMBNNE-UHFFFAOYSA-N
SMILESCCOC1=C(N=CC=C1)C(C(=O)O)(F)F

Computed by PubChem (NCBI)