CAS 1881329-26-5 is the registry number for 1,3-difluoro-5-nitro-2-propoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,3-difluoro-5-nitro-2-propoxybenzene (CAS 1881329-26-5) is a chemical compound with the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. IUPAC name: 1,3-difluoro-5-nitro-2-propoxybenzene. InChIKey: XOMPIDWAHSVALA-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO3 |
|---|---|
| Molecular weight | 217.17 g/mol |
| IUPAC name | 1,3-difluoro-5-nitro-2-propoxybenzene |
| InChIKey | XOMPIDWAHSVALA-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)