CAS 188240-32-6 is the registry number for 4-Oxo valsartan benzyl ester. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 10mg.
Benzyl (2S)-3-methyl-2-[4-oxopentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoate (CAS 188240-32-6) is a chemical compound with the molecular formula C31H33N5O4 and a molecular weight of 539.6 g/mol. IUPAC name: benzyl (2S)-3-methyl-2-[4-oxopentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoate. InChIKey: NAMWOKXTBXOXTP-LJAQVGFWSA-N.
| Molecular formula | C31H33N5O4 |
|---|---|
| Molecular weight | 539.6 g/mol |
| IUPAC name | benzyl (2S)-3-methyl-2-[4-oxopentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoate |
| InChIKey | NAMWOKXTBXOXTP-LJAQVGFWSA-N |
| SMILES | CC(C)[C@@H](C(=O)OCC1=CC=CC=C1)N(CC2=CC=C(C=C2)C3=CC=CC=C3C4=NNN=N4)C(=O)CCC(=O)C |
Computed by PubChem (NCBI)