CAS 18826-13-6 appears in our catalog under these names: 4,4'-Bis(triphenylsilyl)-1,1'-biphenyl, 97%, Poly((9,9-dihexylfluoren-2,7-diyl)-alt-(2,5-dimethyl-1,4-phenylene)) end capped with dimethylphenyl, 4,4'–Bis(triphenylsilyl)–1,1'–biphenyl. Offered by: Chemat Brand, Lumtec, GLPBio. Available pack sizes: on request, 1g.
Triphenyl-[4-(4-triphenylsilylphenyl)phenyl]silane (CAS 18826-13-6) is a chemical compound with the molecular formula C48H38Si2 and a molecular weight of 671.0 g/mol. IUPAC name: triphenyl-[4-(4-triphenylsilylphenyl)phenyl]silane. InChIKey: LNQMQGXHWZCRFZ-UHFFFAOYSA-N.
| Molecular formula | C48H38Si2 |
|---|---|
| Molecular weight | 671.0 g/mol |
| IUPAC name | triphenyl-[4-(4-triphenylsilylphenyl)phenyl]silane |
| InChIKey | LNQMQGXHWZCRFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=C(C=C4)C5=CC=C(C=C5)[Si](C6=CC=CC=C6)(C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)