CAS 18826-15-8 is the registry number for Poly(9,9-di-n -hexylfluorenyl-2,7-vinylene). Offered by: Lumtec. Available pack sizes: On request.
Triphenyl-[3-(3-triphenylsilylphenyl)phenyl]silane (CAS 18826-15-8) is a chemical compound with the molecular formula C48H38Si2 and a molecular weight of 671.0 g/mol. IUPAC name: triphenyl-[3-(3-triphenylsilylphenyl)phenyl]silane. InChIKey: GYIIZSZMHKCZNZ-UHFFFAOYSA-N.
| Molecular formula | C48H38Si2 |
|---|---|
| Molecular weight | 671.0 g/mol |
| IUPAC name | triphenyl-[3-(3-triphenylsilylphenyl)phenyl]silane |
| InChIKey | GYIIZSZMHKCZNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC(=C4)C5=CC(=CC=C5)[Si](C6=CC=CC=C6)(C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)