Products 188290-72-4
CAS 188290-72-4 is the registry number for 4-(Acetoxymethyl)phenyl glucoside. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl acetate (CAS 188290-72-4) is a chemical compound with the molecular formula C15H20O8 and a molecular weight of 328.31 g/mol. IUPAC name: [4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl acetate. InChIKey: PEBFBYZPEKIKRQ-UXXRCYHCSA-N.
| Molecular formula | C15H20O8 |
|---|---|
| Molecular weight | 328.31 g/mol |
| IUPAC name | [4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl acetate |
| InChIKey | PEBFBYZPEKIKRQ-UXXRCYHCSA-N |
| SMILES | CC(=O)OCC1=CC=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(Acetoxymethyl)phenyl glucoside, orb1991303