CAS 912343-81-8 appears in our catalog under these names: (2S,3R,4R,5S,6R)–2–methyl–6–(prop–2–yn–1–yloxy)tetrahydro–2H–pyran–3,4,5–triyl triacetate, Propargyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-2-methyl-6-prop-2-ynoxyoxan-3-yl] acetate (CAS 912343-81-8) is a chemical compound with the molecular formula C15H20O8 and a molecular weight of 328.31 g/mol. IUPAC name: [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-2-methyl-6-prop-2-ynoxyoxan-3-yl] acetate. InChIKey: WVHFUGQYVRPIGA-CELJHQOASA-N.
| Molecular formula | C15H20O8 |
|---|---|
| Molecular weight | 328.31 g/mol |
| IUPAC name | [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-2-methyl-6-prop-2-ynoxyoxan-3-yl] acetate |
| InChIKey | WVHFUGQYVRPIGA-CELJHQOASA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OCC#C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)