CAS 1883302-77-9 is the registry number for (1R,2S)-2-cyanocyclopropanecarboxylic acid, 93%, 93%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Trans-(1R,2S)-2-cyanocyclopropane-1-carboxylic acid (CAS 1883302-77-9) is a chemical compound with the molecular formula C5H5NO2 and a molecular weight of 111.10 g/mol. IUPAC name: trans-(1R,2S)-2-cyanocyclopropane-1-carboxylic acid. InChIKey: MFCBCXRMDAOFOT-QWWZWVQMSA-N.
| Molecular formula | C5H5NO2 |
|---|---|
| Molecular weight | 111.10 g/mol |
| IUPAC name | trans-(1R,2S)-2-cyanocyclopropane-1-carboxylic acid |
| InChIKey | MFCBCXRMDAOFOT-QWWZWVQMSA-N |
| SMILES | C1[C@@H]([C@@H]1C(=O)O)C#N |
Computed by PubChem (NCBI)