CAS 39891-82-2 appears in our catalog under these names: trans-2-Cyanocyclopropanecarboxylic acid, 97%, Trans-2-cyanocyclopropane-1-carboxylic acid, 95%, (1R,2R)-rel-2-Cyanocyclopropanecarboxylic acid 98%, (1R,2R)-rel-2-Cyanocyclopropanecarboxylic acid, 98%, 98%. Offered by: Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
Cis-(1R,2R)-2-cyanocyclopropane-1-carboxylic acid (CAS 39891-82-2) is a chemical compound with the molecular formula C5H5NO2 and a molecular weight of 111.10 g/mol. IUPAC name: cis-(1R,2R)-2-cyanocyclopropane-1-carboxylic acid. InChIKey: MFCBCXRMDAOFOT-IUYQGCFVSA-N.
| Molecular formula | C5H5NO2 |
|---|---|
| Molecular weight | 111.10 g/mol |
| IUPAC name | cis-(1R,2R)-2-cyanocyclopropane-1-carboxylic acid |
| InChIKey | MFCBCXRMDAOFOT-IUYQGCFVSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C#N |
Computed by PubChem (NCBI)