CAS 1883595-39-8 appears in our catalog under these names: Vonoprazan Impurity 24, Vonoprazan Impurity 26, TAK438 Impurity 55, (Z)-N-((5-(2-Fluorophenyl)-1-(pyridin-3-ylsulfonyl)-1H-pyrrol-3-yl)methylene)methanamine Oxide. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanimine oxide (CAS 1883595-39-8) is a chemical compound with the molecular formula C17H14FN3O3S and a molecular weight of 359.4 g/mol. IUPAC name: 1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanimine oxide. InChIKey: HMDIQULSJKUEFI-JAIQZWGSSA-N.
| Molecular formula | C17H14FN3O3S |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanimine oxide |
| InChIKey | HMDIQULSJKUEFI-JAIQZWGSSA-N |
| SMILES | C/[N+](=C/C1=CN(C(=C1)C2=CC=CC=C2F)S(=O)(=O)C3=CN=CC=C3)/[O-] |
Computed by PubChem (NCBI)