CAS 2054536-04-6 appears in our catalog under these names: Vonoprazan Impurity 25, 5-(2-Fluorophenyl)-N-methyl-1-(pyridin-3-ylsulfonyl)-1H-pyrrole-3-carboxamide, 98%, TAK438 Impurity 66. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-(2-fluorophenyl)-N-methyl-1-pyridin-3-ylsulfonylpyrrole-3-carboxamide (CAS 2054536-04-6) is a chemical compound with the molecular formula C17H14FN3O3S and a molecular weight of 359.4 g/mol. IUPAC name: 5-(2-fluorophenyl)-N-methyl-1-pyridin-3-ylsulfonylpyrrole-3-carboxamide. InChIKey: PGVXAHXCXKZZLY-UHFFFAOYSA-N.
| Molecular formula | C17H14FN3O3S |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-N-methyl-1-pyridin-3-ylsulfonylpyrrole-3-carboxamide |
| InChIKey | PGVXAHXCXKZZLY-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CN(C(=C1)C2=CC=CC=C2F)S(=O)(=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)