CAS 18839-88-8 appears in our catalog under these names: Ac-Gln-NH2, Ac–Gln–NH₂. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5000mg, 2000mg, 10000mg.
(2S)-2-acetamidopentanediamide (CAS 18839-88-8) is a chemical compound with the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. IUPAC name: (2S)-2-acetamidopentanediamide. InChIKey: TWPOMVPGGXUNKI-YFKPBYRVSA-N.
| Molecular formula | C7H13N3O3 |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | (2S)-2-acetamidopentanediamide |
| InChIKey | TWPOMVPGGXUNKI-YFKPBYRVSA-N |
| SMILES | CC(=O)N[C@@H](CCC(=O)N)C(=O)N |
Computed by PubChem (NCBI)