CAS 80809-45-6 is the registry number for Ethyl 3-amino-3-(acetamidoimino)propanoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl (3Z)-3-(acetylhydrazinylidene)-3-aminopropanoate (CAS 80809-45-6) is a chemical compound with the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. IUPAC name: ethyl (3Z)-3-(acetylhydrazinylidene)-3-aminopropanoate. InChIKey: KLOICOSVXPGKCC-UHFFFAOYSA-N.
| Molecular formula | C7H13N3O3 |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | ethyl (3Z)-3-(acetylhydrazinylidene)-3-aminopropanoate |
| InChIKey | KLOICOSVXPGKCC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C/C(=N/NC(=O)C)/N |
Computed by PubChem (NCBI)