Products 1884477-63-7
CAS 1884477-63-7 appears in our catalog under these names: (2–(Benzyloxy)–4–cyanophenyl)boronic acid, 2-Benzyloxy-4-cyanophenylboronic acid, 97%, 97%, (2-(Benzyloxy)-4-cyanophenyl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
(4-cyano-2-phenylmethoxyphenyl)boronic acid (CAS 1884477-63-7) is a chemical compound with the molecular formula C14H12BNO3 and a molecular weight of 253.06 g/mol. IUPAC name: (4-cyano-2-phenylmethoxyphenyl)boronic acid. InChIKey: XZRSYTVVAXXTTL-UHFFFAOYSA-N.
| Molecular formula | C14H12BNO3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | (4-cyano-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | XZRSYTVVAXXTTL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C#N)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)