Products 1884496-52-9
CAS 1884496-52-9 is the registry number for Ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg.
Ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2-carboxylate (CAS 1884496-52-9) is a chemical compound with the molecular formula C17H22BNO4 and a molecular weight of 315.2 g/mol. IUPAC name: ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2-carboxylate. InChIKey: KEDKSFBROOTMQW-UHFFFAOYSA-N.
| Molecular formula | C17H22BNO4 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2-carboxylate |
| InChIKey | KEDKSFBROOTMQW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=C(NC3=CC=C2)C(=O)OCC |
Computed by PubChem (NCBI)