CAS 1886-79-9 is the registry number for Maleylsulfanilamide. Offered by: TRC. Available pack sizes: 250mg.
(Z)-4-oxo-4-(4-sulfamoylanilino)but-2-enoic acid (CAS 1886-79-9) is a chemical compound with the molecular formula C10H10N2O5S and a molecular weight of 270.26 g/mol. IUPAC name: (Z)-4-oxo-4-(4-sulfamoylanilino)but-2-enoic acid. InChIKey: XPUWNQCCZQOGTI-WAYWQWQTSA-N.
| Molecular formula | C10H10N2O5S |
|---|---|
| Molecular weight | 270.26 g/mol |
| IUPAC name | (Z)-4-oxo-4-(4-sulfamoylanilino)but-2-enoic acid |
| InChIKey | XPUWNQCCZQOGTI-WAYWQWQTSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)/C=C\C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)