CAS 851288-54-5 appears in our catalog under these names: 2-{(4-(methylsulfanyl)-3-nitrophenyl)formamido}acetic acid, 95%, 2-{(4-(Methylsulfanyl)-3-nitrophenyl)formamido}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-[(4-methylsulfanyl-3-nitrobenzoyl)amino]acetic acid (CAS 851288-54-5) is a chemical compound with the molecular formula C10H10N2O5S and a molecular weight of 270.26 g/mol. IUPAC name: 2-[(4-methylsulfanyl-3-nitrobenzoyl)amino]acetic acid. InChIKey: WPXNZLGDXBPJBT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O5S |
|---|---|
| Molecular weight | 270.26 g/mol |
| IUPAC name | 2-[(4-methylsulfanyl-3-nitrobenzoyl)amino]acetic acid |
| InChIKey | WPXNZLGDXBPJBT-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C=C1)C(=O)NCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)