CAS 18861-58-0 appears in our catalog under these names: (E)-Ethyl 3-(4-bromophenyl)-2-cyanoacrylate, 95+%, Ethyl 3-(4-Bromophenyl)-2-cyanoacrylate. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g.
Ethyl (E)-3-(4-bromophenyl)-2-cyanoprop-2-enoate (CAS 18861-58-0) is a chemical compound with the molecular formula C12H10BrNO2 and a molecular weight of 280.12 g/mol. IUPAC name: ethyl (E)-3-(4-bromophenyl)-2-cyanoprop-2-enoate. InChIKey: MJGTUYOCBQBORS-JXMROGBWSA-N.
| Molecular formula | C12H10BrNO2 |
|---|---|
| Molecular weight | 280.12 g/mol |
| IUPAC name | ethyl (E)-3-(4-bromophenyl)-2-cyanoprop-2-enoate |
| InChIKey | MJGTUYOCBQBORS-JXMROGBWSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC=C(C=C1)Br)/C#N |
Computed by PubChem (NCBI)