Products 1886967-27-6
CAS 1886967-27-6 appears in our catalog under these names: 3-(1,1-Difluoroethyl)bicyclo[1.1.1]pentan-1-amine Hydrochloride, 98%, 98%, 3-(1,1-difluoroethyl)bicyclo[1.1.1]pentan-1-amine,hydrochloride, 98%, 3-(1,1-Difluoroethyl)bicyclo[1.1.1]pentan-1-amine hydrochloride, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-(1,1-difluoroethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 1886967-27-6) is a chemical compound with the molecular formula C7H12ClF2N and a molecular weight of 183.63 g/mol. IUPAC name: 3-(1,1-difluoroethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: TXEOARJKUUZQLG-UHFFFAOYSA-N.
| Molecular formula | C7H12ClF2N |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | 3-(1,1-difluoroethyl)bicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | TXEOARJKUUZQLG-UHFFFAOYSA-N |
| SMILES | CC(C12CC(C1)(C2)N)(F)F.Cl |
Computed by PubChem (NCBI)