CAS 1887237-17-3 is the registry number for Spiro[3H-indole-3,3''-pyrrolidine]-1''-carboxylic acid, 5-bromo-1,2-dihydro-2-oxo-, 1,1-dimethylethyl ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 5g, 10g, 1g.
Tert-butyl 5-bromo-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxylate (CAS 1887237-17-3) is a chemical compound with the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. IUPAC name: tert-butyl 5-bromo-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxylate. InChIKey: LVXKKZPFZOKQOC-UHFFFAOYSA-N.
| Molecular formula | C16H19BrN2O3 |
|---|---|
| Molecular weight | 367.24 g/mol |
| IUPAC name | tert-butyl 5-bromo-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxylate |
| InChIKey | LVXKKZPFZOKQOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)C3=C(C=CC(=C3)Br)NC2=O |
Computed by PubChem (NCBI)