CAS 188797-76-4 appears in our catalog under these names: Ziprasidone N-Oxide, Ziprasidone Impurity 1(N-Oxide), Ziprasidone N-Oxide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-[2-[4-(1,2-benzothiazol-3-yl)-1-oxidopiperazin-1-ium-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one (CAS 188797-76-4) is a chemical compound with the molecular formula C21H21ClN4O2S and a molecular weight of 428.9 g/mol. IUPAC name: 5-[2-[4-(1,2-benzothiazol-3-yl)-1-oxidopiperazin-1-ium-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one. InChIKey: XIEQKITXJALFOJ-UHFFFAOYSA-N.
| Molecular formula | C21H21ClN4O2S |
|---|---|
| Molecular weight | 428.9 g/mol |
| IUPAC name | 5-[2-[4-(1,2-benzothiazol-3-yl)-1-oxidopiperazin-1-ium-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one |
| InChIKey | XIEQKITXJALFOJ-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCN1C2=NSC3=CC=CC=C32)(CCC4=C(C=C5C(=C4)CC(=O)N5)Cl)[O-] |
Computed by PubChem (NCBI)