CAS 884305-08-2 appears in our catalog under these names: Ziprasidone Impurity 1, Ziprasidone Impurity 9, Ziprasidone Impurity 7, Hydroxy ziprasidone, Hydroxy ziprasidone. Offered by: Chemat Brand, Hubei YoungXin, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-1-hydroxyethyl]-6-chloro-1,3-dihydroindol-2-one (CAS 884305-08-2) is a chemical compound with the molecular formula C21H21ClN4O2S and a molecular weight of 428.9 g/mol. IUPAC name: 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-1-hydroxyethyl]-6-chloro-1,3-dihydroindol-2-one. InChIKey: IYNREZQRIITXHB-UHFFFAOYSA-N.
| Molecular formula | C21H21ClN4O2S |
|---|---|
| Molecular weight | 428.9 g/mol |
| IUPAC name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-1-hydroxyethyl]-6-chloro-1,3-dihydroindol-2-one |
| InChIKey | IYNREZQRIITXHB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC(C2=C(C=C3C(=C2)CC(=O)N3)Cl)O)C4=NSC5=CC=CC=C54 |
Computed by PubChem (NCBI)