Products 1888711-12-3
CAS 1888711-12-3 is the registry number for 2-Amino-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide (CAS 1888711-12-3) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: 2-amino-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide. InChIKey: PLHAHKFBBRXQOE-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | 2-amino-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
| InChIKey | PLHAHKFBBRXQOE-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C(C(=O)N)N |
Computed by PubChem (NCBI)