Products 1889076-44-1
CAS 1889076-44-1 is the registry number for tert-Butyl (1-(5-bromothiophen-2-yl)-2-hydroxyethyl)carbamate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-[1-(5-bromothiophen-2-yl)-2-hydroxyethyl]carbamate (CAS 1889076-44-1) is a chemical compound with the molecular formula C11H16BrNO3S and a molecular weight of 322.22 g/mol. IUPAC name: tert-butyl N-[1-(5-bromothiophen-2-yl)-2-hydroxyethyl]carbamate. InChIKey: GKQYLRNRVMYGPV-UHFFFAOYSA-N.
| Molecular formula | C11H16BrNO3S |
|---|---|
| Molecular weight | 322.22 g/mol |
| IUPAC name | tert-butyl N-[1-(5-bromothiophen-2-yl)-2-hydroxyethyl]carbamate |
| InChIKey | GKQYLRNRVMYGPV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)C1=CC=C(S1)Br |
Computed by PubChem (NCBI)