CAS 428471-30-1 is the registry number for N,N-Diethyl 5-bromo-2-methoxybenzenesulfonamide, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
5-bromo-N,N-diethyl-2-methoxybenzenesulfonamide (CAS 428471-30-1) is a chemical compound with the molecular formula C11H16BrNO3S and a molecular weight of 322.22 g/mol. IUPAC name: 5-bromo-N,N-diethyl-2-methoxybenzenesulfonamide. InChIKey: OITONLXAEQJJKF-UHFFFAOYSA-N.
| Molecular formula | C11H16BrNO3S |
|---|---|
| Molecular weight | 322.22 g/mol |
| IUPAC name | 5-bromo-N,N-diethyl-2-methoxybenzenesulfonamide |
| InChIKey | OITONLXAEQJJKF-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=C(C=CC(=C1)Br)OC |
Computed by PubChem (NCBI)