CAS 1890112-83-0 is the registry number for N-([1,1'-Biphenyl]-3-yl)-4-methyl-[1,1'-biphenyl]-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-5-phenyl-N-(3-phenylphenyl)aniline (CAS 1890112-83-0) is a chemical compound with the molecular formula C25H21N and a molecular weight of 335.4 g/mol. IUPAC name: 2-methyl-5-phenyl-N-(3-phenylphenyl)aniline. InChIKey: NZQBCKJKAPGHOR-UHFFFAOYSA-N.
| Molecular formula | C25H21N |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-methyl-5-phenyl-N-(3-phenylphenyl)aniline |
| InChIKey | NZQBCKJKAPGHOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=CC=C2)NC3=CC=CC(=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)