CAS 2123620-84-6 is the registry number for 9,9-Dimethyl-3-(naphthalen-2-yl)-9H-fluoren-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
9,9-dimethyl-3-naphthalen-2-ylfluoren-2-amine (CAS 2123620-84-6) is a chemical compound with the molecular formula C25H21N and a molecular weight of 335.4 g/mol. IUPAC name: 9,9-dimethyl-3-naphthalen-2-ylfluoren-2-amine. InChIKey: RJWDDMQQDXSFLF-UHFFFAOYSA-N.
| Molecular formula | C25H21N |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 9,9-dimethyl-3-naphthalen-2-ylfluoren-2-amine |
| InChIKey | RJWDDMQQDXSFLF-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C(=C3)C4=CC5=CC=CC=C5C=C4)N)C |
Computed by PubChem (NCBI)