Products 1890172-67-4
CAS 1890172-67-4 is the registry number for tert-butyl 3-carbamoyl-3-methylazetidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-carbamoyl-3-methylazetidine-1-carboxylate (CAS 1890172-67-4) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl 3-carbamoyl-3-methylazetidine-1-carboxylate. InChIKey: POWIAFCYNKBBFV-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O3 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | tert-butyl 3-carbamoyl-3-methylazetidine-1-carboxylate |
| InChIKey | POWIAFCYNKBBFV-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(=O)OC(C)(C)C)C(=O)N |
Computed by PubChem (NCBI)