CAS 1890192-22-9 is the registry number for 1–((4–methoxyphenyl)methyl)–1H–indazole–3–carboximidamide hydrochloride. Offered by: GLPBio. Available pack sizes: 1g.
1-[(4-methoxyphenyl)methyl]indazole-3-carboximidamide;hydrochloride (CAS 1890192-22-9) is a chemical compound with the molecular formula C16H17ClN4O and a molecular weight of 316.78 g/mol. IUPAC name: 1-[(4-methoxyphenyl)methyl]indazole-3-carboximidamide;hydrochloride. InChIKey: HNQFZIMLBBQAAP-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN4O |
|---|---|
| Molecular weight | 316.78 g/mol |
| IUPAC name | 1-[(4-methoxyphenyl)methyl]indazole-3-carboximidamide;hydrochloride |
| InChIKey | HNQFZIMLBBQAAP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C3=CC=CC=C3C(=N2)C(=N)N.Cl |
Computed by PubChem (NCBI)