Products 848217-00-5
CAS 848217-00-5 appears in our catalog under these names: H4 Receptor antagonist 1, H4 Receptor antagonist 1, H4 Receptor antagonist 1, 99.66%. Offered by: GLPBio, TargetMol, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 5 mg.
8-chloro-2-methyl-4-(4-methylpiperazin-1-yl)-[1]benzofuro[3,2-d]pyrimidine (CAS 848217-00-5) is a chemical compound with the molecular formula C16H17ClN4O and a molecular weight of 316.78 g/mol. IUPAC name: 8-chloro-2-methyl-4-(4-methylpiperazin-1-yl)-[1]benzofuro[3,2-d]pyrimidine. InChIKey: GUJLUPNSRRNJKP-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN4O |
|---|---|
| Molecular weight | 316.78 g/mol |
| IUPAC name | 8-chloro-2-methyl-4-(4-methylpiperazin-1-yl)-[1]benzofuro[3,2-d]pyrimidine |
| InChIKey | GUJLUPNSRRNJKP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=N1)N3CCN(CC3)C)OC4=C2C=C(C=C4)Cl |
Computed by PubChem (NCBI)