Products 1890250-21-1
CAS 1890250-21-1 appears in our catalog under these names: 5–fluoro AMB metabolite 3, 5-Fluoro amb metabolite 3. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
5-[3-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]carbamoyl]indazol-1-yl]pentanoic acid (CAS 1890250-21-1) is a chemical compound with the molecular formula C19H25N3O5 and a molecular weight of 375.4 g/mol. IUPAC name: 5-[3-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]carbamoyl]indazol-1-yl]pentanoic acid. InChIKey: PHUYBCJFBMJODK-INIZCTEOSA-N.
| Molecular formula | C19H25N3O5 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 5-[3-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]carbamoyl]indazol-1-yl]pentanoic acid |
| InChIKey | PHUYBCJFBMJODK-INIZCTEOSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)NC(=O)C1=NN(C2=CC=CC=C21)CCCCC(=O)O |
Computed by PubChem (NCBI)