CAS 83468-83-1 is the registry number for Boc-his(bom)-oh, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-(phenylmethoxymethyl)imidazol-4-yl]propanoic acid (CAS 83468-83-1) is a chemical compound with the molecular formula C19H25N3O5 and a molecular weight of 375.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-(phenylmethoxymethyl)imidazol-4-yl]propanoic acid. InChIKey: IEAOAWZLUGOPJX-INIZCTEOSA-N.
| Molecular formula | C19H25N3O5 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-(phenylmethoxymethyl)imidazol-4-yl]propanoic acid |
| InChIKey | IEAOAWZLUGOPJX-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CN(C=N1)COCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)