Products 1890452-75-1
CAS 1890452-75-1 appears in our catalog under these names: [2,2-dimethyl-1-(4-phenylphenyl)cyclopropyl]methanol, (1–((1，1'–biphenyl)–4–yl)–2，2–dimethylcyclopropyl)methanol. Offered by: Chemat, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
[2,2-dimethyl-1-(4-phenylphenyl)cyclopropyl]methanol (CAS 1890452-75-1) is a chemical compound with the molecular formula C18H20O and a molecular weight of 252.3 g/mol. IUPAC name: [2,2-dimethyl-1-(4-phenylphenyl)cyclopropyl]methanol. InChIKey: DCSABFVLOHQBJF-UHFFFAOYSA-N.
| Molecular formula | C18H20O |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | [2,2-dimethyl-1-(4-phenylphenyl)cyclopropyl]methanol |
| InChIKey | DCSABFVLOHQBJF-UHFFFAOYSA-N |
| SMILES | CC1(CC1(CO)C2=CC=C(C=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)